C8H10F6N2O2 — CID 581000
2,2,2-trifluoro-N-[4-[(2,2,2-trifluoroacetyl)amino]butyl]acetamide (PubChem CID 581000) has the molecular formula C8H10F6N2O2 and a molecular weight of 280.17 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[4-[(2,2,2-trifluoroacetyl)amino]butyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[4-[(2,2,2-trifluoroacetyl)amino]butyl]acetamide |
|---|---|
| PubChem CID | 581000 |
| Molecular Formula | C8H10F6N2O2 |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2,2,2-trifluoro-N-[4-[(2,2,2-trifluoroacetyl)amino]butyl]acetamide |
| SMILES | O=C(NCCCCNC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H10F6N2O2/c9-7(10,11)5(17)15-3-1-2-4-16-6(18)8(12,13)14/h1-4H2,(H,15,17)(H,16,18) |
| InChIKey | UDCFIGLAHCJHBP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|