C6H6F7NO — CID 103734095
2,2,3,3-tetrafluoro-N-(3,3,3-trifluoropropyl)propanamide (PubChem CID 103734095) has the molecular formula C6H6F7NO and a molecular weight of 241.11 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(3,3,3-trifluoropropyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(3,3,3-trifluoropropyl)propanamide |
|---|---|
| PubChem CID | 103734095 |
| Molecular Formula | C6H6F7NO |
| Molecular Weight | 241.11 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(3,3,3-trifluoropropyl)propanamide |
| SMILES | O=C(NCCC(F)(F)F)C(F)(F)C(F)F |
| InChI | InChI=1S/C6H6F7NO/c7-3(8)6(12,13)4(15)14-2-1-5(9,10)11/h3H,1-2H2,(H,14,15) |
| InChIKey | AVOGRDMWILADDJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.11 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|