C8H10F4N2O2 — CID 103732155
N-[2-(cyclopropylamino)-2-oxoethyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103732155) has the molecular formula C8H10F4N2O2 and a molecular weight of 242.17 g/mol. Its IUPAC name is N-[2-(cyclopropylamino)-2-oxoethyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[2-(cyclopropylamino)-2-oxoethyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103732155 |
| Molecular Formula | C8H10F4N2O2 |
| Molecular Weight | 242.17 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | N-[2-(cyclopropylamino)-2-oxoethyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(CNC(=O)C(F)(F)C(F)F)NC1CC1 |
| InChI | InChI=1S/C8H10F4N2O2/c9-6(10)8(11,12)7(16)13-3-5(15)14-4-1-2-4/h4,6H,1-3H2,(H,13,16)(H,14,15) |
| InChIKey | OHTGDHMNOLULFM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|