C7H16N2O3 — CID 79153179
3-(2,2-dimethoxyethyl)-1,1-dimethylurea (PubChem CID 79153179) has the molecular formula C7H16N2O3 and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-(2,2-dimethoxyethyl)-1,1-dimethylurea.
| Compound Name | 3-(2,2-dimethoxyethyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 79153179 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3-(2,2-dimethoxyethyl)-1,1-dimethylurea |
| SMILES | COC(CNC(=O)N(C)C)OC |
| InChI | InChI=1S/C7H16N2O3/c1-9(2)7(10)8-5-6(11-3)12-4/h6H,5H2,1-4H3,(H,8,10) |
| InChIKey | BZRHJKIGSNCIGW-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|