C6H15N3O2 — CID 10678549
3-[(2S)-2-amino-3-hydroxypropyl]-1,1-dimethylurea (PubChem CID 10678549) has the molecular formula C6H15N3O2 and a molecular weight of 161.20 g/mol. Its IUPAC name is 3-[(2S)-2-amino-3-hydroxypropyl]-1,1-dimethylurea.
| Compound Name | 3-[(2S)-2-amino-3-hydroxypropyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 10678549 |
| Molecular Formula | C6H15N3O2 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 3-[(2S)-2-amino-3-hydroxypropyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC[C@H](N)CO |
| InChI | InChI=1S/C6H15N3O2/c1-9(2)6(11)8-3-5(7)4-10/h5,10H,3-4,7H2,1-2H3,(H,8,11)/t5-/m0/s1 |
| InChIKey | HWRJPZZTXWPMSX-YFKPBYRVSA-N |
| XLogP | -1.42 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |