C11H24N4O2 — CID 112555904
2-amino-N-[2-(dimethylcarbamoylamino)ethyl]-3,3-dimethylbutanamide (PubChem CID 112555904) has the molecular formula C11H24N4O2 and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-amino-N-[2-(dimethylcarbamoylamino)ethyl]-3,3-dimethylbutanamide.
| Compound Name | 2-amino-N-[2-(dimethylcarbamoylamino)ethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 112555904 |
| Molecular Formula | C11H24N4O2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2-amino-N-[2-(dimethylcarbamoylamino)ethyl]-3,3-dimethylbutanamide |
| SMILES | CN(C)C(=O)NCCNC(=O)C(N)C(C)(C)C |
| InChI | InChI=1S/C11H24N4O2/c1-11(2,3)8(12)9(16)13-6-7-14-10(17)15(4)5/h8H,6-7,12H2,1-5H3,(H,13,16)(H,14,17) |
| InChIKey | RKCDUGFSZIXNDK-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|