C10H22N4O2 — CID 83110298
(2S)-2-amino-N-[2-(dimethylcarbamoylamino)ethyl]-3-methylbutanamide (PubChem CID 83110298) has the molecular formula C10H22N4O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(dimethylcarbamoylamino)ethyl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-(dimethylcarbamoylamino)ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 83110298 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (2S)-2-amino-N-[2-(dimethylcarbamoylamino)ethyl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](N)C(=O)NCCNC(=O)N(C)C |
| InChI | InChI=1S/C10H22N4O2/c1-7(2)8(11)9(15)12-5-6-13-10(16)14(3)4/h7-8H,5-6,11H2,1-4H3,(H,12,15)(H,13,16)/t8-/m0/s1 |
| InChIKey | PDKUVQKCAFLONU-QMMMGPOBSA-N |
| XLogP | -0.64 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|