C9H17N3O4 — CID 114898904
3-[2-(dimethylcarbamoylamino)ethylamino]-2-methyl-3-oxopropanoic acid (PubChem CID 114898904) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is 3-[2-(dimethylcarbamoylamino)ethylamino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[2-(dimethylcarbamoylamino)ethylamino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114898904 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 3-[2-(dimethylcarbamoylamino)ethylamino]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)NCCNC(=O)N(C)C |
| InChI | InChI=1S/C9H17N3O4/c1-6(8(14)15)7(13)10-4-5-11-9(16)12(2)3/h6H,4-5H2,1-3H3,(H,10,13)(H,11,16)(H,14,15) |
| InChIKey | YDROJTISWFJLCC-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|