C7H14N2O4 — CID 104936189
4-(dimethylcarbamoylamino)-2-hydroxybutanoic acid (PubChem CID 104936189) has the molecular formula C7H14N2O4 and a molecular weight of 190.20 g/mol. Its IUPAC name is 4-(dimethylcarbamoylamino)-2-hydroxybutanoic acid.
| Compound Name | 4-(dimethylcarbamoylamino)-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104936189 |
| Molecular Formula | C7H14N2O4 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 4-(dimethylcarbamoylamino)-2-hydroxybutanoic acid |
| SMILES | CN(C)C(=O)NCCC(O)C(=O)O |
| InChI | InChI=1S/C7H14N2O4/c1-9(2)7(13)8-4-3-5(10)6(11)12/h5,10H,3-4H2,1-2H3,(H,8,13)(H,11,12) |
| InChIKey | RPTMLYCEEKYFGT-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |