C12H25N3O4 — CID 107839519
(2S)-4-[[2-(dimethylamino)ethyl-propylcarbamoyl]amino]-2-hydroxybutanoic acid (PubChem CID 107839519) has the molecular formula C12H25N3O4 and a molecular weight of 275.35 g/mol. Its IUPAC name is (2S)-4-[[2-(dimethylamino)ethyl-propylcarbamoyl]amino]-2-hydroxybutanoic acid.
| Compound Name | (2S)-4-[[2-(dimethylamino)ethyl-propylcarbamoyl]amino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107839519 |
| Molecular Formula | C12H25N3O4 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | (2S)-4-[[2-(dimethylamino)ethyl-propylcarbamoyl]amino]-2-hydroxybutanoic acid |
| SMILES | CCCN(CCN(C)C)C(=O)NCC[C@H](O)C(=O)O |
| InChI | InChI=1S/C12H25N3O4/c1-4-7-15(9-8-14(2)3)12(19)13-6-5-10(16)11(17)18/h10,16H,4-9H2,1-3H3,(H,13,19)(H,17,18)/t10-/m0/s1 |
| InChIKey | GHQFFYJYUSGWOK-JTQLQIEISA-N |
| XLogP | -0.19 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |