C12H24N2O5 — CID 114007355
(2S)-2-hydroxy-4-[[2-hydroxyethyl(pentan-3-yl)carbamoyl]amino]butanoic acid (PubChem CID 114007355) has the molecular formula C12H24N2O5 and a molecular weight of 276.33 g/mol. Its IUPAC name is (2S)-2-hydroxy-4-[[2-hydroxyethyl(pentan-3-yl)carbamoyl]amino]butanoic acid.
| Compound Name | (2S)-2-hydroxy-4-[[2-hydroxyethyl(pentan-3-yl)carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 114007355 |
| Molecular Formula | C12H24N2O5 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (2S)-2-hydroxy-4-[[2-hydroxyethyl(pentan-3-yl)carbamoyl]amino]butanoic acid |
| SMILES | CCC(CC)N(CCO)C(=O)NCC[C@H](O)C(=O)O |
| InChI | InChI=1S/C12H24N2O5/c1-3-9(4-2)14(7-8-15)12(19)13-6-5-10(16)11(17)18/h9-10,15-16H,3-8H2,1-2H3,(H,13,19)(H,17,18)/t10-/m0/s1 |
| InChIKey | BSAJLOLSNNCDQD-JTQLQIEISA-N |
| XLogP | 0.01 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |