C7H15N3O2S — CID 83117465
N-[2-(dimethylcarbamoylamino)ethyl]-2-sulfanylacetamide (PubChem CID 83117465) has the molecular formula C7H15N3O2S and a molecular weight of 205.28 g/mol. Its IUPAC name is N-[2-(dimethylcarbamoylamino)ethyl]-2-sulfanylacetamide.
| Compound Name | N-[2-(dimethylcarbamoylamino)ethyl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 83117465 |
| Molecular Formula | C7H15N3O2S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-[2-(dimethylcarbamoylamino)ethyl]-2-sulfanylacetamide |
| SMILES | CN(C)C(=O)NCCNC(=O)CS |
| InChI | InChI=1S/C7H15N3O2S/c1-10(2)7(12)9-4-3-8-6(11)5-13/h13H,3-5H2,1-2H3,(H,8,11)(H,9,12) |
| InChIKey | ZETWEFFMNJQKIW-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|