C12H25N5O2 — CID 83121763
N-[2-(dimethylcarbamoylamino)ethyl]-2-piperazin-1-ylpropanamide (PubChem CID 83121763) has the molecular formula C12H25N5O2 and a molecular weight of 271.36 g/mol. Its IUPAC name is N-[2-(dimethylcarbamoylamino)ethyl]-2-piperazin-1-ylpropanamide.
| Compound Name | N-[2-(dimethylcarbamoylamino)ethyl]-2-piperazin-1-ylpropanamide |
|---|---|
| PubChem CID | 83121763 |
| Molecular Formula | C12H25N5O2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | N-[2-(dimethylcarbamoylamino)ethyl]-2-piperazin-1-ylpropanamide |
| SMILES | CC(C(=O)NCCNC(=O)N(C)C)N1CCNCC1 |
| InChI | InChI=1S/C12H25N5O2/c1-10(17-8-6-13-7-9-17)11(18)14-4-5-15-12(19)16(2)3/h10,13H,4-9H2,1-3H3,(H,14,18)(H,15,19) |
| InChIKey | WHEIKHUDSSHSEE-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|