About (2R)-N,N-dimethyl-2-piperazin-1-ylpropanamide
(2R)-N,N-dimethyl-2-piperazin-1-ylpropanamide (PubChem CID 28906098) has the molecular formula C9H19N3O
and a molecular weight of 185.27 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-2-piperazin-1-ylpropanamide.
Molecular Properties
| Compound Name | (2R)-N,N-dimethyl-2-piperazin-1-ylpropanamide |
| PubChem CID | 28906098 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | (2R)-N,N-dimethyl-2-piperazin-1-ylpropanamide |
| SMILES | C[C@H](C(=O)N(C)C)N1CCNCC1 |
| InChI | InChI=1S/C9H19N3O/c1-8(9(13)11(2)3)12-6-4-10-5-7-12/h8,10H,4-7H2,1-3H3/t8-/m1/s1 |
| InChIKey | LKNSAKYAABTMMZ-MRVPVSSYSA-N |
| XLogP | -0.63 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-N,N-dimethyl-2-piperazin-1-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N,N-dimethyl-2-piperazin-1-ylpropanamide?
The IUPAC name of (2R)-N,N-dimethyl-2-piperazin-1-ylpropanamide (CID 28906098) is (2R)-N,N-dimethyl-2-piperazin-1-ylpropanamide.
What is the SMILES notation for (2R)-N,N-dimethyl-2-piperazin-1-ylpropanamide?
The canonical SMILES for (2R)-N,N-dimethyl-2-piperazin-1-ylpropanamide is C[C@H](C(=O)N(C)C)N1CCNCC1.
What is the InChIKey of (2R)-N,N-dimethyl-2-piperazin-1-ylpropanamide?
The InChIKey is LKNSAKYAABTMMZ-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H19N3O/c1-8(9(13)11(2)3)12-6-4-10-5-7-12/h8,10H,4-7H2,1-3H3/t8-/m1/s1.
What are the key properties of (2R)-N,N-dimethyl-2-piperazin-1-ylpropanamide?
(2R)-N,N-dimethyl-2-piperazin-1-ylpropanamide has a molecular weight of 185.27 g/mol, XLogP of -0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N,N-dimethyl-2-piperazin-1-ylpropanamide is sourced from PubChem (CID 28906098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).