C11H21N3O3 — CID 108531294
N'-(2-acetamidoethyl)-N-(3-methylbutyl)oxamide (PubChem CID 108531294) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is N'-(2-acetamidoethyl)-N-(3-methylbutyl)oxamide.
| Compound Name | N'-(2-acetamidoethyl)-N-(3-methylbutyl)oxamide |
|---|---|
| PubChem CID | 108531294 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | N'-(2-acetamidoethyl)-N-(3-methylbutyl)oxamide |
| SMILES | CC(=O)NCCNC(=O)C(=O)NCCC(C)C |
| InChI | InChI=1S/C11H21N3O3/c1-8(2)4-5-13-10(16)11(17)14-7-6-12-9(3)15/h8H,4-7H2,1-3H3,(H,12,15)(H,13,16)(H,14,17) |
| InChIKey | QMGGRTHJUREJBG-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|