C12H24N2O2 — CID 108521757
N'-(3-methylbutyl)-N-pentyloxamide (PubChem CID 108521757) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N'-(3-methylbutyl)-N-pentyloxamide.
| Compound Name | N'-(3-methylbutyl)-N-pentyloxamide |
|---|---|
| PubChem CID | 108521757 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N'-(3-methylbutyl)-N-pentyloxamide |
| SMILES | CCCCCNC(=O)C(=O)NCCC(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-4-5-6-8-13-11(15)12(16)14-9-7-10(2)3/h10H,4-9H2,1-3H3,(H,13,15)(H,14,16) |
| InChIKey | IESBEPOPOKXNDW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|