C21H43N3O3 — CID 143772095
N'-(2-amino-2-oxoethyl)-N-dodecyloxamide;2-methylbutane (PubChem CID 143772095) has the molecular formula C21H43N3O3 and a molecular weight of 385.59 g/mol. Its IUPAC name is N'-(2-amino-2-oxoethyl)-N-dodecyloxamide;2-methylbutane.
| Compound Name | N'-(2-amino-2-oxoethyl)-N-dodecyloxamide;2-methylbutane |
|---|---|
| PubChem CID | 143772095 |
| Molecular Formula | C21H43N3O3 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.33 |
| IUPAC Name | N'-(2-amino-2-oxoethyl)-N-dodecyloxamide;2-methylbutane |
| SMILES | CCC(C)C.CCCCCCCCCCCCNC(=O)C(=O)NCC(N)=O |
| InChI | InChI=1S/C16H31N3O3.C5H12/c1-2-3-4-5-6-7-8-9-10-11-12-18-15(21)16(22)19-13-14(17)20;1-4-5(2)3/h2-13H2,1H3,(H2,17,20)(H,18,21)(H,19,22);5H,4H2,1-3H3 |
| InChIKey | DHGDDOBFKHRJAK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|