C8H18N2O — CID 59108349
1-ethyl-3-methyl-1-(2-methylpropyl)urea (PubChem CID 59108349) has the molecular formula C8H18N2O and a molecular weight of 158.25 g/mol. Its IUPAC name is 1-ethyl-3-methyl-1-(2-methylpropyl)urea.
| Compound Name | 1-ethyl-3-methyl-1-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 59108349 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 1-ethyl-3-methyl-1-(2-methylpropyl)urea |
| SMILES | CCN(CC(C)C)C(=O)NC |
| InChI | InChI=1S/C8H18N2O/c1-5-10(6-7(2)3)8(11)9-4/h7H,5-6H2,1-4H3,(H,9,11) |
| InChIKey | VMTYFWVPFKGHRX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |