C13H38N2O — CID 160547230
1,1-diethyl-3-methylurea;methane;propane (PubChem CID 160547230) has the molecular formula C13H38N2O and a molecular weight of 238.46 g/mol. Its IUPAC name is 1,1-diethyl-3-methylurea;methane;propane.
| Compound Name | 1,1-diethyl-3-methylurea;methane;propane |
|---|---|
| PubChem CID | 160547230 |
| Molecular Formula | C13H38N2O |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 238.30 |
| IUPAC Name | 1,1-diethyl-3-methylurea;methane;propane |
| SMILES | C.C.C.C.CCC.CCN(CC)C(=O)NC |
| InChI | InChI=1S/C6H14N2O.C3H8.4CH4/c1-4-8(5-2)6(9)7-3;1-3-2;;;;/h4-5H2,1-3H3,(H,7,9);3H2,1-2H3;4*1H4 |
| InChIKey | QXOZNWBOHTUQQE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |