C8H18N4O2 — CID 54356119
3-(diethylcarbamoylamino)-1,1-dimethylurea (PubChem CID 54356119) has the molecular formula C8H18N4O2 and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-(diethylcarbamoylamino)-1,1-dimethylurea.
| Compound Name | 3-(diethylcarbamoylamino)-1,1-dimethylurea |
|---|---|
| PubChem CID | 54356119 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 3-(diethylcarbamoylamino)-1,1-dimethylurea |
| SMILES | CCN(CC)C(=O)NNC(=O)N(C)C |
| InChI | InChI=1S/C8H18N4O2/c1-5-12(6-2)8(14)10-9-7(13)11(3)4/h5-6H2,1-4H3,(H,9,13)(H,10,14) |
| InChIKey | QUYVOMKMJLAIQO-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|