C11H23N3OS — CID 79161961
3-(3-carbamothioylpentan-3-yl)-1,1-diethylurea (PubChem CID 79161961) has the molecular formula C11H23N3OS and a molecular weight of 245.39 g/mol. Its IUPAC name is 3-(3-carbamothioylpentan-3-yl)-1,1-diethylurea.
| Compound Name | 3-(3-carbamothioylpentan-3-yl)-1,1-diethylurea |
|---|---|
| PubChem CID | 79161961 |
| Molecular Formula | C11H23N3OS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 3-(3-carbamothioylpentan-3-yl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NC(CC)(CC)C(N)=S |
| InChI | InChI=1S/C11H23N3OS/c1-5-11(6-2,9(12)16)13-10(15)14(7-3)8-4/h5-8H2,1-4H3,(H2,12,16)(H,13,15) |
| InChIKey | LRXSBCRIELYLPA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|