C10H20N2O2S — CID 61121561
N-(3-carbamothioylpentan-3-yl)-2-ethoxyacetamide (PubChem CID 61121561) has the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. Its IUPAC name is N-(3-carbamothioylpentan-3-yl)-2-ethoxyacetamide.
| Compound Name | N-(3-carbamothioylpentan-3-yl)-2-ethoxyacetamide |
|---|---|
| PubChem CID | 61121561 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | N-(3-carbamothioylpentan-3-yl)-2-ethoxyacetamide |
| SMILES | CCOCC(=O)NC(CC)(CC)C(N)=S |
| InChI | InChI=1S/C10H20N2O2S/c1-4-10(5-2,9(11)15)12-8(13)7-14-6-3/h4-7H2,1-3H3,(H2,11,15)(H,12,13) |
| InChIKey | XKROUQLHSCQTNQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|