N,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride

C8H16Cl2N2O2 — CID 88722025

IUPACN,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride
SMILESCCN(CC)C(=O)Cl.CN(C)C(=O)Cl
InChIInChI=1S/C5H10ClNO.C3H6ClNO/c1-3-7(4-2)5(6)8;1-5(2)3(4)6/h3-4H2,1-2H3;1-2H3
InChIKeySSOARRDCGRZMSU-UHFFFAOYSA-N
MW243.13 g/mol
LogP2.59
Rot. Bonds2

About N,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride

N,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride (PubChem CID 88722025) has the molecular formula C8H16Cl2N2O2 and a molecular weight of 243.13 g/mol. Its IUPAC name is N,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride.

Molecular Properties

Compound NameN,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride
PubChem CID88722025
Molecular FormulaC8H16Cl2N2O2
Molecular Weight243.13 g/mol
Exact Mass242.06
IUPAC NameN,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride
SMILESCCN(CC)C(=O)Cl.CN(C)C(=O)Cl
InChIInChI=1S/C5H10ClNO.C3H6ClNO/c1-3-7(4-2)5(6)8;1-5(2)3(4)6/h3-4H2,1-2H3;1-2H3
InChIKeySSOARRDCGRZMSU-UHFFFAOYSA-N
XLogP2.59
TPSA40.62 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.13
LogP ≤ 52.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride?
The IUPAC name of N,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride (CID 88722025) is N,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride.
What is the SMILES notation for N,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride?
The canonical SMILES for N,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride is CCN(CC)C(=O)Cl.CN(C)C(=O)Cl.
What is the InChIKey of N,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride?
The InChIKey is SSOARRDCGRZMSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10ClNO.C3H6ClNO/c1-3-7(4-2)5(6)8;1-5(2)3(4)6/h3-4H2,1-2H3;1-2H3.
What are the key properties of N,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride?
N,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride has a molecular weight of 243.13 g/mol, XLogP of 2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylcarbamoyl chloride;N,N-dimethylcarbamoyl chloride is sourced from PubChem (CID 88722025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).