About N,N-dibutylcarbamoyl chloride;hydrochloride
N,N-dibutylcarbamoyl chloride;hydrochloride (PubChem CID 141018315) has the molecular formula C9H19Cl2NO
and a molecular weight of 228.16 g/mol. Its IUPAC name is N,N-dibutylcarbamoyl chloride;hydrochloride.
Molecular Properties
| Compound Name | N,N-dibutylcarbamoyl chloride;hydrochloride |
| PubChem CID | 141018315 |
| Molecular Formula | C9H19Cl2NO |
| Molecular Weight | 228.16 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | N,N-dibutylcarbamoyl chloride;hydrochloride |
| SMILES | CCCCN(CCCC)C(=O)Cl.Cl |
| InChI | InChI=1S/C9H18ClNO.ClH/c1-3-5-7-11(9(10)12)8-6-4-2;/h3-8H2,1-2H3;1H |
| InChIKey | IEXNMFKBYNFBKX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.16 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibutylcarbamoyl chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutylcarbamoyl chloride;hydrochloride?
The IUPAC name of N,N-dibutylcarbamoyl chloride;hydrochloride (CID 141018315) is N,N-dibutylcarbamoyl chloride;hydrochloride.
What is the SMILES notation for N,N-dibutylcarbamoyl chloride;hydrochloride?
The canonical SMILES for N,N-dibutylcarbamoyl chloride;hydrochloride is CCCCN(CCCC)C(=O)Cl.Cl.
What is the InChIKey of N,N-dibutylcarbamoyl chloride;hydrochloride?
The InChIKey is IEXNMFKBYNFBKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18ClNO.ClH/c1-3-5-7-11(9(10)12)8-6-4-2;/h3-8H2,1-2H3;1H.
What are the key properties of N,N-dibutylcarbamoyl chloride;hydrochloride?
N,N-dibutylcarbamoyl chloride;hydrochloride has a molecular weight of 228.16 g/mol, XLogP of 3.67, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutylcarbamoyl chloride;hydrochloride is sourced from PubChem (CID 141018315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).