2-[butyl(methyl)amino]acetyl chloride

C7H14ClNO — CID 39248237

IUPAC2-[butyl(methyl)amino]acetyl chloride
SMILESCCCCN(C)CC(=O)Cl
InChIInChI=1S/C7H14ClNO/c1-3-4-5-9(2)6-7(8)10/h3-6H2,1-2H3
InChIKeyMBXVKEGBFQBBGR-UHFFFAOYSA-N
MW163.65 g/mol
LogP1.48
Rot. Bonds5

About 2-[butyl(methyl)amino]acetyl chloride

2-[butyl(methyl)amino]acetyl chloride (PubChem CID 39248237) has the molecular formula C7H14ClNO and a molecular weight of 163.65 g/mol. Its IUPAC name is 2-[butyl(methyl)amino]acetyl chloride.

Molecular Properties

Compound Name2-[butyl(methyl)amino]acetyl chloride
PubChem CID39248237
Molecular FormulaC7H14ClNO
Molecular Weight163.65 g/mol
Exact Mass163.08
IUPAC Name2-[butyl(methyl)amino]acetyl chloride
SMILESCCCCN(C)CC(=O)Cl
InChIInChI=1S/C7H14ClNO/c1-3-4-5-9(2)6-7(8)10/h3-6H2,1-2H3
InChIKeyMBXVKEGBFQBBGR-UHFFFAOYSA-N
XLogP1.48
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.65
LogP ≤ 51.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-[butyl(methyl)amino]acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[butyl(methyl)amino]acetyl chloride?
The IUPAC name of 2-[butyl(methyl)amino]acetyl chloride (CID 39248237) is 2-[butyl(methyl)amino]acetyl chloride.
What is the SMILES notation for 2-[butyl(methyl)amino]acetyl chloride?
The canonical SMILES for 2-[butyl(methyl)amino]acetyl chloride is CCCCN(C)CC(=O)Cl.
What is the InChIKey of 2-[butyl(methyl)amino]acetyl chloride?
The InChIKey is MBXVKEGBFQBBGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14ClNO/c1-3-4-5-9(2)6-7(8)10/h3-6H2,1-2H3.
What are the key properties of 2-[butyl(methyl)amino]acetyl chloride?
2-[butyl(methyl)amino]acetyl chloride has a molecular weight of 163.65 g/mol, XLogP of 1.48, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[butyl(methyl)amino]acetyl chloride is sourced from PubChem (CID 39248237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).