About alumanyl 2-[methyl(pentyl)amino]acetate
alumanyl 2-[methyl(pentyl)amino]acetate (PubChem CID 173223235) has the molecular formula C8H18AlNO2
and a molecular weight of 187.22 g/mol. Its IUPAC name is alumanyl 2-[methyl(pentyl)amino]acetate.
Molecular Properties
| Compound Name | alumanyl 2-[methyl(pentyl)amino]acetate |
| PubChem CID | 173223235 |
| Molecular Formula | C8H18AlNO2 |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | alumanyl 2-[methyl(pentyl)amino]acetate |
| SMILES | CCCCCN(C)CC(=O)O[AlH2] |
| InChI | InChI=1S/C8H17NO2.Al.2H/c1-3-4-5-6-9(2)7-8(10)11;;;/h3-7H2,1-2H3,(H,10,11);;;/q;+1;;/p-1 |
| InChIKey | ZLAZRAFCKDFOOV-UHFFFAOYSA-M |
| XLogP | 0.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze alumanyl 2-[methyl(pentyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumanyl 2-[methyl(pentyl)amino]acetate?
The IUPAC name of alumanyl 2-[methyl(pentyl)amino]acetate (CID 173223235) is alumanyl 2-[methyl(pentyl)amino]acetate.
What is the SMILES notation for alumanyl 2-[methyl(pentyl)amino]acetate?
The canonical SMILES for alumanyl 2-[methyl(pentyl)amino]acetate is CCCCCN(C)CC(=O)O[AlH2].
What is the InChIKey of alumanyl 2-[methyl(pentyl)amino]acetate?
The InChIKey is ZLAZRAFCKDFOOV-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H17NO2.Al.2H/c1-3-4-5-6-9(2)7-8(10)11;;;/h3-7H2,1-2H3,(H,10,11);;;/q;+1;;/p-1.
What are the key properties of alumanyl 2-[methyl(pentyl)amino]acetate?
alumanyl 2-[methyl(pentyl)amino]acetate has a molecular weight of 187.22 g/mol, XLogP of 0.20, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for alumanyl 2-[methyl(pentyl)amino]acetate is sourced from PubChem (CID 173223235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).