C25H53N2NaO2 — CID 162182675
sodium;N,N-dimethyloctan-1-amine;2-[dodecyl(methyl)amino]acetate (PubChem CID 162182675) has the molecular formula C25H53N2NaO2 and a molecular weight of 436.70 g/mol. Its IUPAC name is sodium;N,N-dimethyloctan-1-amine;2-[dodecyl(methyl)amino]acetate.
| Compound Name | sodium;N,N-dimethyloctan-1-amine;2-[dodecyl(methyl)amino]acetate |
|---|---|
| PubChem CID | 162182675 |
| Molecular Formula | C25H53N2NaO2 |
| Molecular Weight | 436.70 g/mol |
| Exact Mass | 436.40 |
| IUPAC Name | sodium;N,N-dimethyloctan-1-amine;2-[dodecyl(methyl)amino]acetate |
| SMILES | CCCCCCCCCCCCN(C)CC(=O)[O-].CCCCCCCCN(C)C.[Na+] |
| InChI | InChI=1S/C15H31NO2.C10H23N.Na/c1-3-4-5-6-7-8-9-10-11-12-13-16(2)14-15(17)18;1-4-5-6-7-8-9-10-11(2)3;/h3-14H2,1-2H3,(H,17,18);4-10H2,1-3H3;/q;;+1/p-1 |
| InChIKey | ZPGAUHHRSFZKNA-UHFFFAOYSA-M |
| XLogP | 2.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.70 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|