C10H22N2OS — CID 88793941
1,1-dibutyl-3-methyl-3-sulfanylurea (PubChem CID 88793941) has the molecular formula C10H22N2OS and a molecular weight of 218.37 g/mol. Its IUPAC name is 1,1-dibutyl-3-methyl-3-sulfanylurea.
| Compound Name | 1,1-dibutyl-3-methyl-3-sulfanylurea |
|---|---|
| PubChem CID | 88793941 |
| Molecular Formula | C10H22N2OS |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 1,1-dibutyl-3-methyl-3-sulfanylurea |
| SMILES | CCCCN(CCCC)C(=O)N(C)S |
| InChI | InChI=1S/C10H22N2OS/c1-4-6-8-12(9-7-5-2)10(13)11(3)14/h14H,4-9H2,1-3H3 |
| InChIKey | MBGKCDKBQDGWIZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|