C19H40N2O — CID 139841323
1,1-dimethyl-3,3-dioctylurea (PubChem CID 139841323) has the molecular formula C19H40N2O and a molecular weight of 312.54 g/mol. Its IUPAC name is 1,1-dimethyl-3,3-dioctylurea.
| Compound Name | 1,1-dimethyl-3,3-dioctylurea |
|---|---|
| PubChem CID | 139841323 |
| Molecular Formula | C19H40N2O |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.31 |
| IUPAC Name | 1,1-dimethyl-3,3-dioctylurea |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)N(C)C |
| InChI | InChI=1S/C19H40N2O/c1-5-7-9-11-13-15-17-21(19(22)20(3)4)18-16-14-12-10-8-6-2/h5-18H2,1-4H3 |
| InChIKey | YHYDBAFVMYOWEZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|