C19H40N2O4 — CID 3648902
1-decyl-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,3-dimethylurea (PubChem CID 3648902) has the molecular formula C19H40N2O4 and a molecular weight of 360.54 g/mol. Its IUPAC name is 1-decyl-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,3-dimethylurea.
| Compound Name | 1-decyl-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,3-dimethylurea |
|---|---|
| PubChem CID | 3648902 |
| Molecular Formula | C19H40N2O4 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | 1-decyl-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,3-dimethylurea |
| SMILES | CCCCCCCCCCN(CCOCCOCCO)C(=O)N(C)C |
| InChI | InChI=1S/C19H40N2O4/c1-4-5-6-7-8-9-10-11-12-21(19(23)20(2)3)13-15-24-17-18-25-16-14-22/h22H,4-18H2,1-3H3 |
| InChIKey | LFXJRBQQLMUZQT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|