C15H35NO2 — CID 156751317
ethane;2-[2-[methyl(octyl)amino]ethoxy]ethanol (PubChem CID 156751317) has the molecular formula C15H35NO2 and a molecular weight of 261.45 g/mol. Its IUPAC name is ethane;2-[2-[methyl(octyl)amino]ethoxy]ethanol.
| Compound Name | ethane;2-[2-[methyl(octyl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 156751317 |
| Molecular Formula | C15H35NO2 |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.27 |
| IUPAC Name | ethane;2-[2-[methyl(octyl)amino]ethoxy]ethanol |
| SMILES | CC.CCCCCCCCN(C)CCOCCO |
| InChI | InChI=1S/C13H29NO2.C2H6/c1-3-4-5-6-7-8-9-14(2)10-12-16-13-11-15;1-2/h15H,3-13H2,1-2H3;1-2H3 |
| InChIKey | MEQWLFSLWWYVTC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|