C16H36N2O2 — CID 167513119
N,N'-dimethyl-N-pentyl-N'-[2-(2-propoxyethoxy)ethyl]ethane-1,2-diamine (PubChem CID 167513119) has the molecular formula C16H36N2O2 and a molecular weight of 288.48 g/mol. Its IUPAC name is N,N'-dimethyl-N-pentyl-N'-[2-(2-propoxyethoxy)ethyl]ethane-1,2-diamine.
| Compound Name | N,N'-dimethyl-N-pentyl-N'-[2-(2-propoxyethoxy)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 167513119 |
| Molecular Formula | C16H36N2O2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | N,N'-dimethyl-N-pentyl-N'-[2-(2-propoxyethoxy)ethyl]ethane-1,2-diamine |
| SMILES | CCCCCN(C)CCN(C)CCOCCOCCC |
| InChI | InChI=1S/C16H36N2O2/c1-5-7-8-9-17(3)10-11-18(4)12-14-20-16-15-19-13-6-2/h5-16H2,1-4H3 |
| InChIKey | ABTBMCKOQPRYGZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|