About 1-(dioctylcarbamoyl)-1-methyl-3,3-dioctylurea
1-(dioctylcarbamoyl)-1-methyl-3,3-dioctylurea (PubChem CID 142318742) has the molecular formula C35H71N3O2
and a molecular weight of 565.97 g/mol. Its IUPAC name is 1-(dioctylcarbamoyl)-1-methyl-3,3-dioctylurea.
Molecular Properties
| Compound Name | 1-(dioctylcarbamoyl)-1-methyl-3,3-dioctylurea |
| PubChem CID | 142318742 |
| Molecular Formula | C35H71N3O2 |
| Molecular Weight | 565.97 g/mol |
| Exact Mass | 565.55 |
| IUPAC Name | 1-(dioctylcarbamoyl)-1-methyl-3,3-dioctylurea |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)N(C)C(=O)N(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C35H71N3O2/c1-6-10-14-18-22-26-30-37(31-27-23-19-15-11-7-2)34(39)36(5)35(40)38(32-28-24-20-16-12-8-3)33-29-25-21-17-13-9-4/h6-33H2,1-5H3 |
| InChIKey | FQYIGUQBTLQAHX-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 565.97 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(dioctylcarbamoyl)-1-methyl-3,3-dioctylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dioctylcarbamoyl)-1-methyl-3,3-dioctylurea?
The IUPAC name of 1-(dioctylcarbamoyl)-1-methyl-3,3-dioctylurea (CID 142318742) is 1-(dioctylcarbamoyl)-1-methyl-3,3-dioctylurea.
What is the SMILES notation for 1-(dioctylcarbamoyl)-1-methyl-3,3-dioctylurea?
The canonical SMILES for 1-(dioctylcarbamoyl)-1-methyl-3,3-dioctylurea is CCCCCCCCN(CCCCCCCC)C(=O)N(C)C(=O)N(CCCCCCCC)CCCCCCCC.
What is the InChIKey of 1-(dioctylcarbamoyl)-1-methyl-3,3-dioctylurea?
The InChIKey is FQYIGUQBTLQAHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H71N3O2/c1-6-10-14-18-22-26-30-37(31-27-23-19-15-11-7-2)34(39)36(5)35(40)38(32-28-24-20-16-12-8-3)33-29-25-21-17-13-9-4/h6-33H2,1-5H3.
What are the key properties of 1-(dioctylcarbamoyl)-1-methyl-3,3-dioctylurea?
1-(dioctylcarbamoyl)-1-methyl-3,3-dioctylurea has a molecular weight of 565.97 g/mol, XLogP of 11.20, 28 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dioctylcarbamoyl)-1-methyl-3,3-dioctylurea is sourced from PubChem (CID 142318742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).