About 1-butyl-1-(chloromethyl)-3,3-dimethylurea
1-butyl-1-(chloromethyl)-3,3-dimethylurea (PubChem CID 21398164) has the molecular formula C8H17ClN2O
and a molecular weight of 192.69 g/mol. Its IUPAC name is 1-butyl-1-(chloromethyl)-3,3-dimethylurea.
Molecular Properties
| Compound Name | 1-butyl-1-(chloromethyl)-3,3-dimethylurea |
| PubChem CID | 21398164 |
| Molecular Formula | C8H17ClN2O |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 1-butyl-1-(chloromethyl)-3,3-dimethylurea |
| SMILES | CCCCN(CCl)C(=O)N(C)C |
| InChI | InChI=1S/C8H17ClN2O/c1-4-5-6-11(7-9)8(12)10(2)3/h4-7H2,1-3H3 |
| InChIKey | FIFFEUKLKIHOEM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-1-(chloromethyl)-3,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-1-(chloromethyl)-3,3-dimethylurea?
The IUPAC name of 1-butyl-1-(chloromethyl)-3,3-dimethylurea (CID 21398164) is 1-butyl-1-(chloromethyl)-3,3-dimethylurea.
What is the SMILES notation for 1-butyl-1-(chloromethyl)-3,3-dimethylurea?
The canonical SMILES for 1-butyl-1-(chloromethyl)-3,3-dimethylurea is CCCCN(CCl)C(=O)N(C)C.
What is the InChIKey of 1-butyl-1-(chloromethyl)-3,3-dimethylurea?
The InChIKey is FIFFEUKLKIHOEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17ClN2O/c1-4-5-6-11(7-9)8(12)10(2)3/h4-7H2,1-3H3.
What are the key properties of 1-butyl-1-(chloromethyl)-3,3-dimethylurea?
1-butyl-1-(chloromethyl)-3,3-dimethylurea has a molecular weight of 192.69 g/mol, XLogP of 1.97, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-1-(chloromethyl)-3,3-dimethylurea is sourced from PubChem (CID 21398164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).