C17H34NNaOS — CID 87721857
sodium N,N-dioctylcarbamothioate (PubChem CID 87721857) has the molecular formula C17H34NNaOS and a molecular weight of 323.52 g/mol. Its IUPAC name is sodium N,N-dioctylcarbamothioate.
| Compound Name | sodium N,N-dioctylcarbamothioate |
|---|---|
| PubChem CID | 87721857 |
| Molecular Formula | C17H34NNaOS |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | sodium N,N-dioctylcarbamothioate |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)[S-].[Na+] |
| InChI | InChI=1S/C17H35NOS.Na/c1-3-5-7-9-11-13-15-18(17(19)20)16-14-12-10-8-6-4-2;/h3-16H2,1-2H3,(H,19,20);/q;+1/p-1 |
| InChIKey | YZXULLHJQCKNTE-UHFFFAOYSA-M |
| XLogP | 2.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|