C10H20CaN2O2S2 — CID 118002498
calcium;N,N-dibutylcarbamothioate;carbamothioate (PubChem CID 118002498) has the molecular formula C10H20CaN2O2S2 and a molecular weight of 304.49 g/mol. Its IUPAC name is calcium;N,N-dibutylcarbamothioate;carbamothioate.
| Compound Name | calcium;N,N-dibutylcarbamothioate;carbamothioate |
|---|---|
| PubChem CID | 118002498 |
| Molecular Formula | C10H20CaN2O2S2 |
| Molecular Weight | 304.49 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | calcium;N,N-dibutylcarbamothioate;carbamothioate |
| SMILES | CCCCN(CCCC)C(=O)[S-].NC(=O)[S-].[Ca+2] |
| InChI | InChI=1S/C9H19NOS.CH3NOS.Ca/c1-3-5-7-10(9(11)12)8-6-4-2;2-1(3)4;/h3-8H2,1-2H3,(H,11,12);(H3,2,3,4);/q;;+2/p-2 |
| InChIKey | XDOULMHNDAIQCI-UHFFFAOYSA-L |
| XLogP | 1.79 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|