C11H17N3OS — CID 151507405
1,1-diethyl-3-(phenylsulfanylamino)urea (PubChem CID 151507405) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 1,1-diethyl-3-(phenylsulfanylamino)urea.
| Compound Name | 1,1-diethyl-3-(phenylsulfanylamino)urea |
|---|---|
| PubChem CID | 151507405 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1,1-diethyl-3-(phenylsulfanylamino)urea |
| SMILES | CCN(CC)C(=O)NNSc1ccccc1 |
| InChI | InChI=1S/C11H17N3OS/c1-3-14(4-2)11(15)12-13-16-10-8-6-5-7-9-10/h5-9,13H,3-4H2,1-2H3,(H,12,15) |
| InChIKey | PRSKEQAFDWQKOJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|