C9H18N2O2 — CID 177056307
N',N'-diethyl-N-methylbutanediamide (PubChem CID 177056307) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is N',N'-diethyl-N-methylbutanediamide.
| Compound Name | N',N'-diethyl-N-methylbutanediamide |
|---|---|
| PubChem CID | 177056307 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | N',N'-diethyl-N-methylbutanediamide |
| SMILES | CCN(CC)C(=O)CCC(=O)NC |
| InChI | InChI=1S/C9H18N2O2/c1-4-11(5-2)9(13)7-6-8(12)10-3/h4-7H2,1-3H3,(H,10,12) |
| InChIKey | PDIYWOFGNHBLCK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |