C12H27N3O3S — CID 178139900
N,N-diethylbutanamide;2-[(hydroxyamino)methylsulfanyl]-N-methylacetamide (PubChem CID 178139900) has the molecular formula C12H27N3O3S and a molecular weight of 293.43 g/mol. Its IUPAC name is N,N-diethylbutanamide;2-[(hydroxyamino)methylsulfanyl]-N-methylacetamide.
| Compound Name | N,N-diethylbutanamide;2-[(hydroxyamino)methylsulfanyl]-N-methylacetamide |
|---|---|
| PubChem CID | 178139900 |
| Molecular Formula | C12H27N3O3S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N,N-diethylbutanamide;2-[(hydroxyamino)methylsulfanyl]-N-methylacetamide |
| SMILES | CCCC(=O)N(CC)CC.CNC(=O)CSCNO |
| InChI | InChI=1S/C8H17NO.C4H10N2O2S/c1-4-7-8(10)9(5-2)6-3;1-5-4(7)2-9-3-6-8/h4-7H2,1-3H3;6,8H,2-3H2,1H3,(H,5,7) |
| InChIKey | BDHLGBQIJWSNEY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|