C9H19N3O2 — CID 115588408
N,N-diethyl-3-(methylcarbamoylamino)propanamide (PubChem CID 115588408) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is N,N-diethyl-3-(methylcarbamoylamino)propanamide.
| Compound Name | N,N-diethyl-3-(methylcarbamoylamino)propanamide |
|---|---|
| PubChem CID | 115588408 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N,N-diethyl-3-(methylcarbamoylamino)propanamide |
| SMILES | CCN(CC)C(=O)CCNC(=O)NC |
| InChI | InChI=1S/C9H19N3O2/c1-4-12(5-2)8(13)6-7-11-9(14)10-3/h4-7H2,1-3H3,(H2,10,11,14) |
| InChIKey | UGVNNNHQARHCJS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |