C11H24N2O2 — CID 143532923
3-acetamido-N,N-diethylpropanamide;ethane (PubChem CID 143532923) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 3-acetamido-N,N-diethylpropanamide;ethane.
| Compound Name | 3-acetamido-N,N-diethylpropanamide;ethane |
|---|---|
| PubChem CID | 143532923 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 3-acetamido-N,N-diethylpropanamide;ethane |
| SMILES | CC.CCN(CC)C(=O)CCNC(C)=O |
| InChI | InChI=1S/C9H18N2O2.C2H6/c1-4-11(5-2)9(13)6-7-10-8(3)12;1-2/h4-7H2,1-3H3,(H,10,12);1-2H3 |
| InChIKey | IYVREQADIPNUSH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |