2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid

C9H13F3N2O4 — CID 79258622

IUPAC2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid
SMILESCC(=O)NCCC(=O)N(CC(=O)O)CC(F)(F)F
InChIInChI=1S/C9H13F3N2O4/c1-6(15)13-3-2-7(16)14(4-8(17)18)5-9(10,11)12/h2-5H2,1H3,(H,13,15)(H,17,18)
InChIKeyORAZSRPGNYWIME-UHFFFAOYSA-N
MW270.21 g/mol
LogP-0.01
Rot. Bonds6

About 2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid

2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79258622) has the molecular formula C9H13F3N2O4 and a molecular weight of 270.21 g/mol. Its IUPAC name is 2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid.

Molecular Properties

Compound Name2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid
PubChem CID79258622
Molecular FormulaC9H13F3N2O4
Molecular Weight270.21 g/mol
Exact Mass270.08
IUPAC Name2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid
SMILESCC(=O)NCCC(=O)N(CC(=O)O)CC(F)(F)F
InChIInChI=1S/C9H13F3N2O4/c1-6(15)13-3-2-7(16)14(4-8(17)18)5-9(10,11)12/h2-5H2,1H3,(H,13,15)(H,17,18)
InChIKeyORAZSRPGNYWIME-UHFFFAOYSA-N
XLogP-0.01
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.21
LogP ≤ 5-0.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid?
The IUPAC name of 2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid (CID 79258622) is 2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid.
What is the SMILES notation for 2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid?
The canonical SMILES for 2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid is CC(=O)NCCC(=O)N(CC(=O)O)CC(F)(F)F.
What is the InChIKey of 2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid?
The InChIKey is ORAZSRPGNYWIME-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N2O4/c1-6(15)13-3-2-7(16)14(4-8(17)18)5-9(10,11)12/h2-5H2,1H3,(H,13,15)(H,17,18).
What are the key properties of 2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid?
2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid has a molecular weight of 270.21 g/mol, XLogP of -0.01, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-acetamidopropanoyl(2,2,2-trifluoroethyl)amino]acetic acid is sourced from PubChem (CID 79258622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).