About S-[2-(methylamino)-2-oxoethyl] hexanethioate
S-[2-(methylamino)-2-oxoethyl] hexanethioate (PubChem CID 11557503) has the molecular formula C9H17NO2S
and a molecular weight of 203.31 g/mol. Its IUPAC name is S-[2-(methylamino)-2-oxoethyl] hexanethioate.
Molecular Properties
| Compound Name | S-[2-(methylamino)-2-oxoethyl] hexanethioate |
| PubChem CID | 11557503 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | S-[2-(methylamino)-2-oxoethyl] hexanethioate |
| SMILES | CCCCCC(=O)SCC(=O)NC |
| InChI | InChI=1S/C9H17NO2S/c1-3-4-5-6-9(12)13-7-8(11)10-2/h3-7H2,1-2H3,(H,10,11) |
| InChIKey | PCCUUZYMPQCACD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-(methylamino)-2-oxoethyl] hexanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-(methylamino)-2-oxoethyl] hexanethioate?
The IUPAC name of S-[2-(methylamino)-2-oxoethyl] hexanethioate (CID 11557503) is S-[2-(methylamino)-2-oxoethyl] hexanethioate.
What is the SMILES notation for S-[2-(methylamino)-2-oxoethyl] hexanethioate?
The canonical SMILES for S-[2-(methylamino)-2-oxoethyl] hexanethioate is CCCCCC(=O)SCC(=O)NC.
What is the InChIKey of S-[2-(methylamino)-2-oxoethyl] hexanethioate?
The InChIKey is PCCUUZYMPQCACD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2S/c1-3-4-5-6-9(12)13-7-8(11)10-2/h3-7H2,1-2H3,(H,10,11).
What are the key properties of S-[2-(methylamino)-2-oxoethyl] hexanethioate?
S-[2-(methylamino)-2-oxoethyl] hexanethioate has a molecular weight of 203.31 g/mol, XLogP of 1.57, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-(methylamino)-2-oxoethyl] hexanethioate is sourced from PubChem (CID 11557503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).