About S-octanoyl octanethioate
S-octanoyl octanethioate (PubChem CID 12951368) has the molecular formula C16H30O2S
and a molecular weight of 286.48 g/mol. Its IUPAC name is S-octanoyl octanethioate.
Molecular Properties
| Compound Name | S-octanoyl octanethioate |
| PubChem CID | 12951368 |
| Molecular Formula | C16H30O2S |
| Molecular Weight | 286.48 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | S-octanoyl octanethioate |
| SMILES | CCCCCCCC(=O)SC(=O)CCCCCCC |
| InChI | InChI=1S/C16H30O2S/c1-3-5-7-9-11-13-15(17)19-16(18)14-12-10-8-6-4-2/h3-14H2,1-2H3 |
| InChIKey | AUJUQSVHHMTUQR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-octanoyl octanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-octanoyl octanethioate?
The IUPAC name of S-octanoyl octanethioate (CID 12951368) is S-octanoyl octanethioate.
What is the SMILES notation for S-octanoyl octanethioate?
The canonical SMILES for S-octanoyl octanethioate is CCCCCCCC(=O)SC(=O)CCCCCCC.
What is the InChIKey of S-octanoyl octanethioate?
The InChIKey is AUJUQSVHHMTUQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2S/c1-3-5-7-9-11-13-15(17)19-16(18)14-12-10-8-6-4-2/h3-14H2,1-2H3.
What are the key properties of S-octanoyl octanethioate?
S-octanoyl octanethioate has a molecular weight of 286.48 g/mol, XLogP of 5.49, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-octanoyl octanethioate is sourced from PubChem (CID 12951368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).