About S-octanoyl octanethioate;triethoxy(propyl)silane
S-octanoyl octanethioate;triethoxy(propyl)silane (PubChem CID 175133378) has the molecular formula C25H52O5SSi
and a molecular weight of 492.84 g/mol. Its IUPAC name is S-octanoyl octanethioate;triethoxy(propyl)silane.
Molecular Properties
| Compound Name | S-octanoyl octanethioate;triethoxy(propyl)silane |
| PubChem CID | 175133378 |
| Molecular Formula | C25H52O5SSi |
| Molecular Weight | 492.84 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | S-octanoyl octanethioate;triethoxy(propyl)silane |
| SMILES | CCCCCCCC(=O)SC(=O)CCCCCCC.CCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C16H30O2S.C9H22O3Si/c1-3-5-7-9-11-13-15(17)19-16(18)14-12-10-8-6-4-2;1-5-9-13(10-6-2,11-7-3)12-8-4/h3-14H2,1-2H3;5-9H2,1-4H3 |
| InChIKey | GOTHVZSPXHZQQV-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.84 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-octanoyl octanethioate;triethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-octanoyl octanethioate;triethoxy(propyl)silane?
The IUPAC name of S-octanoyl octanethioate;triethoxy(propyl)silane (CID 175133378) is S-octanoyl octanethioate;triethoxy(propyl)silane.
What is the SMILES notation for S-octanoyl octanethioate;triethoxy(propyl)silane?
The canonical SMILES for S-octanoyl octanethioate;triethoxy(propyl)silane is CCCCCCCC(=O)SC(=O)CCCCCCC.CCC[Si](OCC)(OCC)OCC.
What is the InChIKey of S-octanoyl octanethioate;triethoxy(propyl)silane?
The InChIKey is GOTHVZSPXHZQQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2S.C9H22O3Si/c1-3-5-7-9-11-13-15(17)19-16(18)14-12-10-8-6-4-2;1-5-9-13(10-6-2,11-7-3)12-8-4/h3-14H2,1-2H3;5-9H2,1-4H3.
What are the key properties of S-octanoyl octanethioate;triethoxy(propyl)silane?
S-octanoyl octanethioate;triethoxy(propyl)silane has a molecular weight of 492.84 g/mol, XLogP of 7.94, 20 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-octanoyl octanethioate;triethoxy(propyl)silane is sourced from PubChem (CID 175133378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).