C8H18N2O2 — CID 83030843
1,1-diethyl-3-[(2R)-2-hydroxypropyl]urea (PubChem CID 83030843) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is 1,1-diethyl-3-[(2R)-2-hydroxypropyl]urea.
| Compound Name | 1,1-diethyl-3-[(2R)-2-hydroxypropyl]urea |
|---|---|
| PubChem CID | 83030843 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 1,1-diethyl-3-[(2R)-2-hydroxypropyl]urea |
| SMILES | CCN(CC)C(=O)NC[C@@H](C)O |
| InChI | InChI=1S/C8H18N2O2/c1-4-10(5-2)8(12)9-6-7(3)11/h7,11H,4-6H2,1-3H3,(H,9,12)/t7-/m1/s1 |
| InChIKey | QJCLKJUKXGZKII-SSDOTTSWSA-N |
| XLogP | 0.42 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |