C9H21N3O — CID 79154789
3-(3-amino-2-methylpropyl)-1,1-diethylurea (PubChem CID 79154789) has the molecular formula C9H21N3O and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-(3-amino-2-methylpropyl)-1,1-diethylurea.
| Compound Name | 3-(3-amino-2-methylpropyl)-1,1-diethylurea |
|---|---|
| PubChem CID | 79154789 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 3-(3-amino-2-methylpropyl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCC(C)CN |
| InChI | InChI=1S/C9H21N3O/c1-4-12(5-2)9(13)11-7-8(3)6-10/h8H,4-7,10H2,1-3H3,(H,11,13) |
| InChIKey | ARZGDEQVEDEWBO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |