C9H20N2O2 — CID 79161473
1,1-diethyl-3-(3-hydroxybutyl)urea (PubChem CID 79161473) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1,1-diethyl-3-(3-hydroxybutyl)urea.
| Compound Name | 1,1-diethyl-3-(3-hydroxybutyl)urea |
|---|---|
| PubChem CID | 79161473 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 1,1-diethyl-3-(3-hydroxybutyl)urea |
| SMILES | CCN(CC)C(=O)NCCC(C)O |
| InChI | InChI=1S/C9H20N2O2/c1-4-11(5-2)9(13)10-7-6-8(3)12/h8,12H,4-7H2,1-3H3,(H,10,13) |
| InChIKey | FWMWQQIIMKGTBT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |