C10H20N2O3 — CID 61184764
2-[ethyl(3-methylbutylcarbamoyl)amino]acetic acid (PubChem CID 61184764) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-[ethyl(3-methylbutylcarbamoyl)amino]acetic acid.
| Compound Name | 2-[ethyl(3-methylbutylcarbamoyl)amino]acetic acid |
|---|---|
| PubChem CID | 61184764 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-[ethyl(3-methylbutylcarbamoyl)amino]acetic acid |
| SMILES | CCN(CC(=O)O)C(=O)NCCC(C)C |
| InChI | InChI=1S/C10H20N2O3/c1-4-12(7-9(13)14)10(15)11-6-5-8(2)3/h8H,4-7H2,1-3H3,(H,11,15)(H,13,14) |
| InChIKey | KQCGSOOEOSNJSU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |