C10H22N2O — CID 15539164
3-methyl-1,1-bis(2-methylpropyl)urea (PubChem CID 15539164) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 3-methyl-1,1-bis(2-methylpropyl)urea.
| Compound Name | 3-methyl-1,1-bis(2-methylpropyl)urea |
|---|---|
| PubChem CID | 15539164 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 3-methyl-1,1-bis(2-methylpropyl)urea |
| SMILES | CNC(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C10H22N2O/c1-8(2)6-12(7-9(3)4)10(13)11-5/h8-9H,6-7H2,1-5H3,(H,11,13) |
| InChIKey | URMPXBCEIIOFBV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |